C47H40N4 — CID 139525721
9-[4-[4-(4-cyclohexa-1,5-dien-1-yl-5,6-diphenylpyrimidin-2-yl)cyclohex-2-en-1-yl]cyclohexa-2,4-dien-1-yl]-7,8-dihydrocarbazole-3-carbonitrile (PubChem CID 139525721) has the molecular formula C47H40N4 and a molecular weight of 660.87 g/mol. Its IUPAC name is 9-[4-[4-(4-cyclohexa-1,5-dien-1-yl-5,6-diphenylpyrimidin-2-yl)cyclohex-2-en-1-yl]cyclohexa-2,4-dien-1-yl]-7,8-dihydrocarbazole-3-carbonitrile.
| Compound Name | 9-[4-[4-(4-cyclohexa-1,5-dien-1-yl-5,6-diphenylpyrimidin-2-yl)cyclohex-2-en-1-yl]cyclohexa-2,4-dien-1-yl]-7,8-dihydrocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 139525721 |
| Molecular Formula | C47H40N4 |
| Molecular Weight | 660.87 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | 9-[4-[4-(4-cyclohexa-1,5-dien-1-yl-5,6-diphenylpyrimidin-2-yl)cyclohex-2-en-1-yl]cyclohexa-2,4-dien-1-yl]-7,8-dihydrocarbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1c(n2C2C=CC(C3C=CC(c4nc(C5=CCCC=C5)c(-c5ccccc5)c(-c5ccccc5)n4)CC3)=CC2)CCC=C1 |
| InChI | InChI=1S/C47H40N4/c48-31-32-20-29-43-41(30-32)40-18-10-11-19-42(40)51(43)39-27-25-34(26-28-39)33-21-23-38(24-22-33)47-49-45(36-14-6-2-7-15-36)44(35-12-4-1-5-13-35)46(50-47)37-16-8-3-9-17-37/h1-2,4-8,10,12-18,20-21,23,25-27,29-30,33,38-39H,3,9,11,19,22,24,28H2 |
| InChIKey | ZPLGUVFHVLJNKP-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.87 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|