C58H41N3 — CID 177276905
9-[4-(6-cyclohexa-1,5-dien-1-yl-2-phenylpyrimidin-4-yl)-2,6-diphenylphenyl]-3,6-diphenylcarbazole (PubChem CID 177276905) has the molecular formula C58H41N3 and a molecular weight of 779.99 g/mol. Its IUPAC name is 9-[4-(6-cyclohexa-1,5-dien-1-yl-2-phenylpyrimidin-4-yl)-2,6-diphenylphenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[4-(6-cyclohexa-1,5-dien-1-yl-2-phenylpyrimidin-4-yl)-2,6-diphenylphenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 177276905 |
| Molecular Formula | C58H41N3 |
| Molecular Weight | 779.99 g/mol |
| Exact Mass | 779.33 |
| IUPAC Name | 9-[4-(6-cyclohexa-1,5-dien-1-yl-2-phenylpyrimidin-4-yl)-2,6-diphenylphenyl]-3,6-diphenylcarbazole |
| SMILES | C1=CC(c2cc(-c3cc(-c4ccccc4)c(-n4c5ccc(-c6ccccc6)cc5c5cc(-c6ccccc6)ccc54)c(-c4ccccc4)c3)nc(-c3ccccc3)n2)=CCC1 |
| InChI | InChI=1S/C58H41N3/c1-7-19-40(20-8-1)46-31-33-55-51(35-46)52-36-47(41-21-9-2-10-22-41)32-34-56(52)61(55)57-49(42-23-11-3-12-24-42)37-48(38-50(57)43-25-13-4-14-26-43)54-39-53(44-27-15-5-16-28-44)59-58(60-54)45-29-17-6-18-30-45/h1-4,6-15,17-39H,5,16H2 |
| InChIKey | PSZGOJIDSZFIAR-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.99 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |