C62H38N8 — CID 169037222
11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-12-(4-phenanthren-3-yl-6-phenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazole (PubChem CID 169037222) has the molecular formula C62H38N8 and a molecular weight of 895.04 g/mol. Its IUPAC name is 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-12-(4-phenanthren-3-yl-6-phenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazole.
| Compound Name | 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-12-(4-phenanthren-3-yl-6-phenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 169037222 |
| Molecular Formula | C62H38N8 |
| Molecular Weight | 895.04 g/mol |
| Exact Mass | 894.32 |
| IUPAC Name | 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-12-(4-phenanthren-3-yl-6-phenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5ccc6c7ccccc7n(-c7nc(-c8ccccc8)nc(-c8ccc9ccc%10ccccc%10c9c8)n7)c6c54)cc3)n2)cc1 |
| InChI | InChI=1S/C62H38N8/c1-4-17-41(18-5-1)57-63-58(42-19-6-2-7-20-42)65-59(64-57)44-32-34-46(35-33-44)69-53-26-14-12-24-48(53)50-36-37-51-49-25-13-15-27-54(49)70(56(51)55(50)69)62-67-60(43-21-8-3-9-22-43)66-61(68-62)45-31-30-40-29-28-39-16-10-11-23-47(39)52(40)38-45/h1-38H |
| InChIKey | ILIKPOVSFIMKCI-UHFFFAOYSA-N |
| XLogP | 14.89 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.04 |
| LogP ≤ 5 | 14.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|