C16H14N4O2 — CID 169040252
1-(4-aminophenyl)-3a-hydroxy-2,3-dihydropyrrolo[2,3-b][1,7]naphthyridin-4-one (PubChem CID 169040252) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3a-hydroxy-2,3-dihydropyrrolo[2,3-b][1,7]naphthyridin-4-one.
| Compound Name | 1-(4-aminophenyl)-3a-hydroxy-2,3-dihydropyrrolo[2,3-b][1,7]naphthyridin-4-one |
|---|---|
| PubChem CID | 169040252 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1-(4-aminophenyl)-3a-hydroxy-2,3-dihydropyrrolo[2,3-b][1,7]naphthyridin-4-one |
| SMILES | Nc1ccc(N2CCC3(O)C(=O)c4ccncc4N=C23)cc1 |
| InChI | InChI=1S/C16H14N4O2/c17-10-1-3-11(4-2-10)20-8-6-16(22)14(21)12-5-7-18-9-13(12)19-15(16)20/h1-5,7,9,22H,6,8,17H2 |
| InChIKey | WITVOHSQJHXSAP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|