C21H18N6O2 — CID 169041178
2-[[4-[1-(4-methoxyphenyl)-4-methyl-6-oxo-4,5-dihydropyridazin-3-yl]phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169041178) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[[4-[1-(4-methoxyphenyl)-4-methyl-6-oxo-4,5-dihydropyridazin-3-yl]phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[4-[1-(4-methoxyphenyl)-4-methyl-6-oxo-4,5-dihydropyridazin-3-yl]phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169041178 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[[4-[1-(4-methoxyphenyl)-4-methyl-6-oxo-4,5-dihydropyridazin-3-yl]phenyl]hydrazinylidene]propanedinitrile |
| SMILES | COc1ccc(N2N=C(c3ccc(NN=C(C#N)C#N)cc3)C(C)CC2=O)cc1 |
| InChI | InChI=1S/C21H18N6O2/c1-14-11-20(28)27(18-7-9-19(29-2)10-8-18)26-21(14)15-3-5-16(6-4-15)24-25-17(12-22)13-23/h3-10,14,24H,11H2,1-2H3 |
| InChIKey | FZTXOKDSOPILTH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|