About bis(dec-9-ynyl) hydrogen phosphate
bis(dec-9-ynyl) hydrogen phosphate (PubChem CID 169041587) has the molecular formula C20H35O4P
and a molecular weight of 370.47 g/mol. Its IUPAC name is bis(dec-9-ynyl) hydrogen phosphate.
Molecular Properties
| Compound Name | bis(dec-9-ynyl) hydrogen phosphate |
| PubChem CID | 169041587 |
| Molecular Formula | C20H35O4P |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | bis(dec-9-ynyl) hydrogen phosphate |
| SMILES | C#CCCCCCCCCOP(=O)(O)OCCCCCCCCC#C |
| InChI | InChI=1S/C20H35O4P/c1-3-5-7-9-11-13-15-17-19-23-25(21,22)24-20-18-16-14-12-10-8-6-4-2/h1-2H,5-20H2,(H,21,22) |
| InChIKey | OUNXRDWWLQXNMY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(dec-9-ynyl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dec-9-ynyl) hydrogen phosphate?
The IUPAC name of bis(dec-9-ynyl) hydrogen phosphate (CID 169041587) is bis(dec-9-ynyl) hydrogen phosphate.
What is the SMILES notation for bis(dec-9-ynyl) hydrogen phosphate?
The canonical SMILES for bis(dec-9-ynyl) hydrogen phosphate is C#CCCCCCCCCOP(=O)(O)OCCCCCCCCC#C.
What is the InChIKey of bis(dec-9-ynyl) hydrogen phosphate?
The InChIKey is OUNXRDWWLQXNMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35O4P/c1-3-5-7-9-11-13-15-17-19-23-25(21,22)24-20-18-16-14-12-10-8-6-4-2/h1-2H,5-20H2,(H,21,22).
What are the key properties of bis(dec-9-ynyl) hydrogen phosphate?
bis(dec-9-ynyl) hydrogen phosphate has a molecular weight of 370.47 g/mol, XLogP of 5.85, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dec-9-ynyl) hydrogen phosphate is sourced from PubChem (CID 169041587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).