C20H40O13P2 — CID 176740779
2-[2-[2-[2-[2-[2-[ethoxy(hydroxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hex-5-ynyl hydrogen phosphate (PubChem CID 176740779) has the molecular formula C20H40O13P2 and a molecular weight of 550.48 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[ethoxy(hydroxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hex-5-ynyl hydrogen phosphate.
| Compound Name | 2-[2-[2-[2-[2-[2-[ethoxy(hydroxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hex-5-ynyl hydrogen phosphate |
|---|---|
| PubChem CID | 176740779 |
| Molecular Formula | C20H40O13P2 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[ethoxy(hydroxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hex-5-ynyl hydrogen phosphate |
| SMILES | C#CCCCCOP(=O)(O)OCCOCCOCCOCCOCCOCCOP(=O)(O)OCC |
| InChI | InChI=1S/C20H40O13P2/c1-3-5-6-7-8-31-35(23,24)33-20-18-29-16-14-27-12-10-25-9-11-26-13-15-28-17-19-32-34(21,22)30-4-2/h1H,4-20H2,2H3,(H,21,22)(H,23,24) |
| InChIKey | CMBYOCGUVILSBY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|