C19H22Cl2N2 — CID 169042731
(2S,5S)-2,5-bis[(4-chlorophenyl)methyl]-1-methylpiperazine (PubChem CID 169042731) has the molecular formula C19H22Cl2N2 and a molecular weight of 349.31 g/mol. Its IUPAC name is (2S,5S)-2,5-bis[(4-chlorophenyl)methyl]-1-methylpiperazine.
| Compound Name | (2S,5S)-2,5-bis[(4-chlorophenyl)methyl]-1-methylpiperazine |
|---|---|
| PubChem CID | 169042731 |
| Molecular Formula | C19H22Cl2N2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (2S,5S)-2,5-bis[(4-chlorophenyl)methyl]-1-methylpiperazine |
| SMILES | CN1C[C@H](Cc2ccc(Cl)cc2)NC[C@@H]1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N2/c1-23-13-18(10-14-2-6-16(20)7-3-14)22-12-19(23)11-15-4-8-17(21)9-5-15/h2-9,18-19,22H,10-13H2,1H3/t18-,19-/m0/s1 |
| InChIKey | GWOLBQUZTRXMCW-OALUTQOASA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |