C16H26N2O2S — CID 169045175
(4S,5R)-5-methyl-1-methylsulfonyl-N-[(1S)-1-phenylethyl]azepan-4-amine (PubChem CID 169045175) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is (4S,5R)-5-methyl-1-methylsulfonyl-N-[(1S)-1-phenylethyl]azepan-4-amine.
| Compound Name | (4S,5R)-5-methyl-1-methylsulfonyl-N-[(1S)-1-phenylethyl]azepan-4-amine |
|---|---|
| PubChem CID | 169045175 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (4S,5R)-5-methyl-1-methylsulfonyl-N-[(1S)-1-phenylethyl]azepan-4-amine |
| SMILES | C[C@H](N[C@H]1CCN(S(C)(=O)=O)CC[C@H]1C)c1ccccc1 |
| InChI | InChI=1S/C16H26N2O2S/c1-13-9-11-18(21(3,19)20)12-10-16(13)17-14(2)15-7-5-4-6-8-15/h4-8,13-14,16-17H,9-12H2,1-3H3/t13-,14+,16+/m1/s1 |
| InChIKey | ZQONYCDABTVHIQ-YCPHGPKFSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |