C11H7BrClF3N4 — CID 169045945
N-[(2-bromopyrimidin-5-yl)methyl]-2-chloro-6-(trifluoromethyl)pyridin-4-amine (PubChem CID 169045945) has the molecular formula C11H7BrClF3N4 and a molecular weight of 367.56 g/mol. Its IUPAC name is N-[(2-bromopyrimidin-5-yl)methyl]-2-chloro-6-(trifluoromethyl)pyridin-4-amine.
| Compound Name | N-[(2-bromopyrimidin-5-yl)methyl]-2-chloro-6-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 169045945 |
| Molecular Formula | C11H7BrClF3N4 |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | N-[(2-bromopyrimidin-5-yl)methyl]-2-chloro-6-(trifluoromethyl)pyridin-4-amine |
| SMILES | FC(F)(F)c1cc(NCc2cnc(Br)nc2)cc(Cl)n1 |
| InChI | InChI=1S/C11H7BrClF3N4/c12-10-18-4-6(5-19-10)3-17-7-1-8(11(14,15)16)20-9(13)2-7/h1-2,4-5H,3H2,(H,17,20) |
| InChIKey | IVVURYBMYOQIQC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|