About sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol
sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol (PubChem CID 160647175) has the molecular formula C7H9BClF3NNaO
and a molecular weight of 249.40 g/mol. Its IUPAC name is sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol.
Molecular Properties
| Compound Name | sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol |
| PubChem CID | 160647175 |
| Molecular Formula | C7H9BClF3NNaO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol |
| SMILES | OCc1cc(Cl)nc(C(F)(F)F)c1.[BH4-].[Na+] |
| InChI | InChI=1S/C7H5ClF3NO.BH4.Na/c8-6-2-4(3-13)1-5(12-6)7(9,10)11;;/h1-2,13H,3H2;1H4;/q;-1;+1 |
| InChIKey | RJXZPLVFFWVWJJ-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol?
The IUPAC name of sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol (CID 160647175) is sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol.
What is the SMILES notation for sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol?
The canonical SMILES for sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol is OCc1cc(Cl)nc(C(F)(F)F)c1.[BH4-].[Na+].
What is the InChIKey of sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol?
The InChIKey is RJXZPLVFFWVWJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClF3NO.BH4.Na/c8-6-2-4(3-13)1-5(12-6)7(9,10)11;;/h1-2,13H,3H2;1H4;/q;-1;+1.
What are the key properties of sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol?
sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol has a molecular weight of 249.40 g/mol, XLogP of -2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;boranuide;[2-chloro-6-(trifluoromethyl)-4-pyridinyl]methanol is sourced from PubChem (CID 160647175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).