C56H60CoF6N4O8 — CID 169046236
cobalt(2+);bis(2,2,2-trifluoroethyl (5Z)-5-[(4-ethoxycarbonyl-3,5-dimethylpyrrol-1-id-2-yl)-(2,4,6-trimethylphenyl)methylidene]-2,4-dimethylpyrrole-3-carboxylate) (PubChem CID 169046236) has the molecular formula C56H60CoF6N4O8 and a molecular weight of 1090.04 g/mol. Its IUPAC name is cobalt(2+);bis(2,2,2-trifluoroethyl (5Z)-5-[(4-ethoxycarbonyl-3,5-dimethylpyrrol-1-id-2-yl)-(2,4,6-trimethylphenyl)methylidene]-2,4-dimethylpyrrole-3-carboxylate).
| Compound Name | cobalt(2+);bis(2,2,2-trifluoroethyl (5Z)-5-[(4-ethoxycarbonyl-3,5-dimethylpyrrol-1-id-2-yl)-(2,4,6-trimethylphenyl)methylidene]-2,4-dimethylpyrrole-3-carboxylate) |
|---|---|
| PubChem CID | 169046236 |
| Molecular Formula | C56H60CoF6N4O8 |
| Molecular Weight | 1090.04 g/mol |
| Exact Mass | 1089.36 |
| IUPAC Name | cobalt(2+);bis(2,2,2-trifluoroethyl (5Z)-5-[(4-ethoxycarbonyl-3,5-dimethylpyrrol-1-id-2-yl)-(2,4,6-trimethylphenyl)methylidene]-2,4-dimethylpyrrole-3-carboxylate) |
| SMILES | CCOC(=O)c1c(C)[n-]c(/C(=C2\N=C(C)C(C(=O)OCC(F)(F)F)=C2C)c2c(C)cc(C)cc2C)c1C.CCOC(=O)c1c(C)[n-]c(/C(=C2\N=C(C)C(C(=O)OCC(F)(F)F)=C2C)c2c(C)cc(C)cc2C)c1C.[Co+2] |
| InChI | InChI=1S/2C28H31F3N2O4.Co/c2*1-9-36-26(34)21-16(5)24(32-18(21)7)23(20-14(3)10-13(2)11-15(20)4)25-17(6)22(19(8)33-25)27(35)37-12-28(29,30)31;/h2*10-11H,9,12H2,1-8H3,(H,32,33,34,35);/q;;+2/p-2 |
| InChIKey | MDEJCZLRYXPKGQ-UHFFFAOYSA-L |
| XLogP | 12.03 |
| TPSA | 158.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.04 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|