C25H31ClN6O2 — CID 169048349
(5R)-2-[(1S,6R)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 169048349) has the molecular formula C25H31ClN6O2 and a molecular weight of 483.02 g/mol. Its IUPAC name is (5R)-2-[(1S,6R)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | (5R)-2-[(1S,6R)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169048349 |
| Molecular Formula | C25H31ClN6O2 |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (5R)-2-[(1S,6R)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(C)NC[C@@H](C(=O)N1CCN(c2ncc3c(n2)NC(=O)C[C@H]3C)[C@H]2C[C@H]21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H31ClN6O2/c1-14(2)27-13-19(16-4-6-17(26)7-5-16)24(34)31-8-9-32(21-11-20(21)31)25-28-12-18-15(3)10-22(33)29-23(18)30-25/h4-7,12,14-15,19-21,27H,8-11,13H2,1-3H3,(H,28,29,30,33)/t15-,19-,20-,21+/m1/s1 |
| InChIKey | GQGMMBSOVILLSE-DOVSJBTNSA-N |
| XLogP | 3.15 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |