C18H16N4 — CID 169050221
5-[4-(1H-imidazol-5-yl)-2,6-dimethylnaphthalen-1-yl]-1H-imidazole (PubChem CID 169050221) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-[4-(1H-imidazol-5-yl)-2,6-dimethylnaphthalen-1-yl]-1H-imidazole.
| Compound Name | 5-[4-(1H-imidazol-5-yl)-2,6-dimethylnaphthalen-1-yl]-1H-imidazole |
|---|---|
| PubChem CID | 169050221 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5-[4-(1H-imidazol-5-yl)-2,6-dimethylnaphthalen-1-yl]-1H-imidazole |
| SMILES | Cc1ccc2c(-c3cnc[nH]3)c(C)cc(-c3cnc[nH]3)c2c1 |
| InChI | InChI=1S/C18H16N4/c1-11-3-4-13-14(5-11)15(16-7-19-9-21-16)6-12(2)18(13)17-8-20-10-22-17/h3-10H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | USXLQLLKGJKELH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |