C13H16N2 — CID 171381974
5-[(1R)-1-(2,4-dimethylphenyl)ethyl]-1H-imidazole (PubChem CID 171381974) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-[(1R)-1-(2,4-dimethylphenyl)ethyl]-1H-imidazole.
| Compound Name | 5-[(1R)-1-(2,4-dimethylphenyl)ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 171381974 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 5-[(1R)-1-(2,4-dimethylphenyl)ethyl]-1H-imidazole |
| SMILES | Cc1ccc([C@@H](C)c2cnc[nH]2)c(C)c1 |
| InChI | InChI=1S/C13H16N2/c1-9-4-5-12(10(2)6-9)11(3)13-7-14-8-15-13/h4-8,11H,1-3H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | VZRZAXXUNVSFRS-LLVKDONJSA-N |
| XLogP | 3.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |