C18H30N2O — CID 143737677
2,4-dimethyl-1-propoxybenzene;ethane;5-ethyl-1H-imidazole (PubChem CID 143737677) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,4-dimethyl-1-propoxybenzene;ethane;5-ethyl-1H-imidazole.
| Compound Name | 2,4-dimethyl-1-propoxybenzene;ethane;5-ethyl-1H-imidazole |
|---|---|
| PubChem CID | 143737677 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 2,4-dimethyl-1-propoxybenzene;ethane;5-ethyl-1H-imidazole |
| SMILES | CC.CCCOc1ccc(C)cc1C.CCc1cnc[nH]1 |
| InChI | InChI=1S/C11H16O.C5H8N2.C2H6/c1-4-7-12-11-6-5-9(2)8-10(11)3;1-2-5-3-6-4-7-5;1-2/h5-6,8H,4,7H2,1-3H3;3-4H,2H2,1H3,(H,6,7);1-2H3 |
| InChIKey | LODQXFGXDXTNHG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |