C16H24N2O2 — CID 143737660
5-ethyl-1H-imidazole;4-methoxy-2-methyl-1-propoxybenzene (PubChem CID 143737660) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 5-ethyl-1H-imidazole;4-methoxy-2-methyl-1-propoxybenzene.
| Compound Name | 5-ethyl-1H-imidazole;4-methoxy-2-methyl-1-propoxybenzene |
|---|---|
| PubChem CID | 143737660 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 5-ethyl-1H-imidazole;4-methoxy-2-methyl-1-propoxybenzene |
| SMILES | CCCOc1ccc(OC)cc1C.CCc1cnc[nH]1 |
| InChI | InChI=1S/C11H16O2.C5H8N2/c1-4-7-13-11-6-5-10(12-3)8-9(11)2;1-2-5-3-6-4-7-5/h5-6,8H,4,7H2,1-3H3;3-4H,2H2,1H3,(H,6,7) |
| InChIKey | BGTINIOEMKAGRF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |