About CID 69201774
CID 69201774 (PubChem CID 69201774) has the molecular formula C20H26BO4
and a molecular weight of 341.24 g/mol.
Molecular Properties
| Compound Name | CID 69201774 |
| PubChem CID | 69201774 |
| Molecular Formula | C20H26BO4 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | — |
| SMILES | CCCOc1ccc(O[B]Oc2ccc(OCCC)c(C)c2)cc1C |
| InChI | InChI=1S/C20H26BO4/c1-5-11-22-19-9-7-17(13-15(19)3)24-21-25-18-8-10-20(16(4)14-18)23-12-6-2/h7-10,13-14H,5-6,11-12H2,1-4H3 |
| InChIKey | LZXHTQAXTHAGLW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 69201774 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69201774?
The IUPAC name of CID 69201774 (CID 69201774) is not available.
What is the SMILES notation for CID 69201774?
The canonical SMILES for CID 69201774 is CCCOc1ccc(O[B]Oc2ccc(OCCC)c(C)c2)cc1C.
What is the InChIKey of CID 69201774?
The InChIKey is LZXHTQAXTHAGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26BO4/c1-5-11-22-19-9-7-17(13-15(19)3)24-21-25-18-8-10-20(16(4)14-18)23-12-6-2/h7-10,13-14H,5-6,11-12H2,1-4H3.
What are the key properties of CID 69201774?
CID 69201774 has a molecular weight of 341.24 g/mol, XLogP of 4.87, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69201774 is sourced from PubChem (CID 69201774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).