C13H20I2O2 — CID 142841816
1,4-bis(2-iodoethoxy)-2-methylbenzene;ethane (PubChem CID 142841816) has the molecular formula C13H20I2O2 and a molecular weight of 462.11 g/mol. Its IUPAC name is 1,4-bis(2-iodoethoxy)-2-methylbenzene;ethane.
| Compound Name | 1,4-bis(2-iodoethoxy)-2-methylbenzene;ethane |
|---|---|
| PubChem CID | 142841816 |
| Molecular Formula | C13H20I2O2 |
| Molecular Weight | 462.11 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | 1,4-bis(2-iodoethoxy)-2-methylbenzene;ethane |
| SMILES | CC.Cc1cc(OCCI)ccc1OCCI |
| InChI | InChI=1S/C11H14I2O2.C2H6/c1-9-8-10(14-6-4-12)2-3-11(9)15-7-5-13;1-2/h2-3,8H,4-7H2,1H3;1-2H3 |
| InChIKey | IAPNHRSLIOYMBO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.11 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|