C25H23O2S+ — CID 169050568
2-(3-methylcyclopent-2-en-1-yl)but-3-yn-2-yl 4-(1-benzothiophen-1-ium-1-yl)benzoate (PubChem CID 169050568) has the molecular formula C25H23O2S+ and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-(3-methylcyclopent-2-en-1-yl)but-3-yn-2-yl 4-(1-benzothiophen-1-ium-1-yl)benzoate.
| Compound Name | 2-(3-methylcyclopent-2-en-1-yl)but-3-yn-2-yl 4-(1-benzothiophen-1-ium-1-yl)benzoate |
|---|---|
| PubChem CID | 169050568 |
| Molecular Formula | C25H23O2S+ |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-(3-methylcyclopent-2-en-1-yl)but-3-yn-2-yl 4-(1-benzothiophen-1-ium-1-yl)benzoate |
| SMILES | C#CC(C)(OC(=O)c1ccc(-[s+]2ccc3ccccc32)cc1)C1C=C(C)CC1 |
| InChI | InChI=1S/C25H23O2S/c1-4-25(3,21-12-9-18(2)17-21)27-24(26)20-10-13-22(14-11-20)28-16-15-19-7-5-6-8-23(19)28/h1,5-8,10-11,13-17,21H,9,12H2,2-3H3/q+1 |
| InChIKey | MGBBMCFCYKHGSB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|