C26H25O2S+ — CID 169051047
2-cyclohex-2-en-1-ylbut-3-yn-2-yl 3-(3-methyl-1-benzothiophen-1-ium-1-yl)benzoate (PubChem CID 169051047) has the molecular formula C26H25O2S+ and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-ylbut-3-yn-2-yl 3-(3-methyl-1-benzothiophen-1-ium-1-yl)benzoate.
| Compound Name | 2-cyclohex-2-en-1-ylbut-3-yn-2-yl 3-(3-methyl-1-benzothiophen-1-ium-1-yl)benzoate |
|---|---|
| PubChem CID | 169051047 |
| Molecular Formula | C26H25O2S+ |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-cyclohex-2-en-1-ylbut-3-yn-2-yl 3-(3-methyl-1-benzothiophen-1-ium-1-yl)benzoate |
| SMILES | C#CC(C)(OC(=O)c1cccc(-[s+]2cc(C)c3ccccc32)c1)C1C=CCCC1 |
| InChI | InChI=1S/C26H25O2S/c1-4-26(3,21-12-6-5-7-13-21)28-25(27)20-11-10-14-22(17-20)29-18-19(2)23-15-8-9-16-24(23)29/h1,6,8-12,14-18,21H,5,7,13H2,2-3H3/q+1 |
| InChIKey | MRRVNUHGJZZTCZ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|