C5H3Cl3N2O — CID 169052382
(E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride (PubChem CID 169052382) has the molecular formula C5H3Cl3N2O and a molecular weight of 213.45 g/mol. Its IUPAC name is (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride.
| Compound Name | (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride |
|---|---|
| PubChem CID | 169052382 |
| Molecular Formula | C5H3Cl3N2O |
| Molecular Weight | 213.45 g/mol |
| Exact Mass | 211.93 |
| IUPAC Name | (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride |
| SMILES | [H]/N=C(Cl)/C=C(Cl)\C(=N\[H])C(=O)Cl |
| InChI | InChI=1S/C5H3Cl3N2O/c6-2(1-3(7)9)4(10)5(8)11/h1,9-10H/b2-1+,9-3-,10-4- |
| InChIKey | QKCAGMIUYHLBDS-SWKMESFRSA-N |
| XLogP | 2.11 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|