(E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride

C5H3Cl3N2O — CID 169052382

IUPAC(E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride
SMILES[H]/N=C(Cl)/C=C(Cl)\C(=N\[H])C(=O)Cl
InChIInChI=1S/C5H3Cl3N2O/c6-2(1-3(7)9)4(10)5(8)11/h1,9-10H/b2-1+,9-3-,10-4-
InChIKeyQKCAGMIUYHLBDS-SWKMESFRSA-N
MW213.45 g/mol
LogP2.11
Rot. Bonds3

About (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride

(E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride (PubChem CID 169052382) has the molecular formula C5H3Cl3N2O and a molecular weight of 213.45 g/mol. Its IUPAC name is (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride.

Molecular Properties

Compound Name(E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride
PubChem CID169052382
Molecular FormulaC5H3Cl3N2O
Molecular Weight213.45 g/mol
Exact Mass211.93
IUPAC Name(E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride
SMILES[H]/N=C(Cl)/C=C(Cl)\C(=N\[H])C(=O)Cl
InChIInChI=1S/C5H3Cl3N2O/c6-2(1-3(7)9)4(10)5(8)11/h1,9-10H/b2-1+,9-3-,10-4-
InChIKeyQKCAGMIUYHLBDS-SWKMESFRSA-N
XLogP2.11
TPSA64.77 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.45
LogP ≤ 52.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride?
The IUPAC name of (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride (CID 169052382) is (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride.
What is the SMILES notation for (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride?
The canonical SMILES for (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride is [H]/N=C(Cl)/C=C(Cl)\C(=N\[H])C(=O)Cl.
What is the InChIKey of (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride?
The InChIKey is QKCAGMIUYHLBDS-SWKMESFRSA-N. The full InChI is InChI=1S/C5H3Cl3N2O/c6-2(1-3(7)9)4(10)5(8)11/h1,9-10H/b2-1+,9-3-,10-4-.
What are the key properties of (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride?
(E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride has a molecular weight of 213.45 g/mol, XLogP of 2.11, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,5-dichloro-2,5-diiminopent-3-enoyl chloride is sourced from PubChem (CID 169052382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).