C63H58N+ — CID 169054236
6-[3-[2,4-diphenyl-3-[4-(2,3,6-triphenylphenyl)phenyl]phenyl]phenyl]hexyl-trimethylazanium (PubChem CID 169054236) has the molecular formula C63H58N+ and a molecular weight of 829.16 g/mol. Its IUPAC name is 6-[3-[2,4-diphenyl-3-[4-(2,3,6-triphenylphenyl)phenyl]phenyl]phenyl]hexyl-trimethylazanium.
| Compound Name | 6-[3-[2,4-diphenyl-3-[4-(2,3,6-triphenylphenyl)phenyl]phenyl]phenyl]hexyl-trimethylazanium |
|---|---|
| PubChem CID | 169054236 |
| Molecular Formula | C63H58N+ |
| Molecular Weight | 829.16 g/mol |
| Exact Mass | 828.46 |
| IUPAC Name | 6-[3-[2,4-diphenyl-3-[4-(2,3,6-triphenylphenyl)phenyl]phenyl]phenyl]hexyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCCCCc1cccc(-c2ccc(-c3ccccc3)c(-c3ccc(-c4c(-c5ccccc5)ccc(-c5ccccc5)c4-c4ccccc4)cc3)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C63H58N/c1-64(2,3)45-22-5-4-11-24-47-25-23-36-55(46-47)59-44-43-58(50-30-16-8-17-31-50)63(61(59)52-34-20-10-21-35-52)54-39-37-53(38-40-54)62-57(49-28-14-7-15-29-49)42-41-56(48-26-12-6-13-27-48)60(62)51-32-18-9-19-33-51/h6-10,12-21,23,25-44,46H,4-5,11,22,24,45H2,1-3H3/q+1 |
| InChIKey | OEHPCUQNRHWVCU-UHFFFAOYSA-N |
| XLogP | 16.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.16 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|