C28H43N3O12 — CID 169054627
2-[[4-[[2-carboxyethyl(methyl)amino]methyl]benzoyl]amino]-4-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxymethoxy]butanoic acid (PubChem CID 169054627) has the molecular formula C28H43N3O12 and a molecular weight of 613.66 g/mol. Its IUPAC name is 2-[[4-[[2-carboxyethyl(methyl)amino]methyl]benzoyl]amino]-4-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxymethoxy]butanoic acid.
| Compound Name | 2-[[4-[[2-carboxyethyl(methyl)amino]methyl]benzoyl]amino]-4-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxymethoxy]butanoic acid |
|---|---|
| PubChem CID | 169054627 |
| Molecular Formula | C28H43N3O12 |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | 2-[[4-[[2-carboxyethyl(methyl)amino]methyl]benzoyl]amino]-4-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxymethoxy]butanoic acid |
| SMILES | CC(=O)COCCOCCNC(=O)COCCOCOCCC(NC(=O)c1ccc(CN(C)CCC(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C28H43N3O12/c1-21(32)18-40-14-13-39-12-9-29-25(33)19-41-15-16-43-20-42-11-8-24(28(37)38)30-27(36)23-5-3-22(4-6-23)17-31(2)10-7-26(34)35/h3-6,24H,7-20H2,1-2H3,(H,29,33)(H,30,36)(H,34,35)(H,37,38) |
| InChIKey | MAMZKIPQWYYFGK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 199.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|