C17H15N5O7S2 — CID 16905791
4-methyl-3,5-dinitro-N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]benzenesulfonamide (PubChem CID 16905791) has the molecular formula C17H15N5O7S2 and a molecular weight of 465.47 g/mol. Its IUPAC name is 4-methyl-3,5-dinitro-N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-3,5-dinitro-N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16905791 |
| Molecular Formula | C17H15N5O7S2 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 4-methyl-3,5-dinitro-N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)NCCn2nc(-c3cccs3)ccc2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N5O7S2/c1-11-14(21(24)25)9-12(10-15(11)22(26)27)31(28,29)18-6-7-20-17(23)5-4-13(19-20)16-3-2-8-30-16/h2-5,8-10,18H,6-7H2,1H3 |
| InChIKey | DYNSDGFFBJGYJO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 167.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|