C56H28F3N9 — CID 169060006
9-[2-[5-(3-cyano-6-isocyanocarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(trifluoromethyl)phenyl]carbazole-3,6-dicarbonitrile (PubChem CID 169060006) has the molecular formula C56H28F3N9 and a molecular weight of 883.90 g/mol. Its IUPAC name is 9-[2-[5-(3-cyano-6-isocyanocarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(trifluoromethyl)phenyl]carbazole-3,6-dicarbonitrile.
| Compound Name | 9-[2-[5-(3-cyano-6-isocyanocarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(trifluoromethyl)phenyl]carbazole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 169060006 |
| Molecular Formula | C56H28F3N9 |
| Molecular Weight | 883.90 g/mol |
| Exact Mass | 883.24 |
| IUPAC Name | 9-[2-[5-(3-cyano-6-isocyanocarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(trifluoromethyl)phenyl]carbazole-3,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(C#N)ccc1n2-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2cccc(C(F)(F)F)c2-n2c3ccc(C#N)cc3c3cc(C#N)ccc32)c1 |
| InChI | InChI=1S/C56H28F3N9/c1-63-38-18-24-49-46(28-38)45-27-33(30-60)15-21-48(45)67(49)39-19-20-41(55-65-53(36-9-4-2-5-10-36)64-54(66-55)37-11-6-3-7-12-37)42(29-39)40-13-8-14-47(56(57,58)59)52(40)68-50-22-16-34(31-61)25-43(50)44-26-35(32-62)17-23-51(44)68/h2-29H |
| InChIKey | HRSNENVEVACDEI-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 124.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.90 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|