C15H17ClN4OS — CID 169061207
(3R)-4-[3-chloro-7-(2-isocyanopropan-2-yl)-[1,2]thiazolo[4,5-b]pyridin-5-yl]-3-methylmorpholine (PubChem CID 169061207) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is (3R)-4-[3-chloro-7-(2-isocyanopropan-2-yl)-[1,2]thiazolo[4,5-b]pyridin-5-yl]-3-methylmorpholine.
| Compound Name | (3R)-4-[3-chloro-7-(2-isocyanopropan-2-yl)-[1,2]thiazolo[4,5-b]pyridin-5-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 169061207 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (3R)-4-[3-chloro-7-(2-isocyanopropan-2-yl)-[1,2]thiazolo[4,5-b]pyridin-5-yl]-3-methylmorpholine |
| SMILES | [C-]#[N+]C(C)(C)c1cc(N2CCOC[C@H]2C)nc2c(Cl)nsc12 |
| InChI | InChI=1S/C15H17ClN4OS/c1-9-8-21-6-5-20(9)11-7-10(15(2,3)17-4)13-12(18-11)14(16)19-22-13/h7,9H,5-6,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | LNBBNDUTWNQNIB-SECBINFHSA-N |
| XLogP | 3.72 |
| TPSA | 42.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|