C17H21ClN4O2S — CID 169061211
4-[3-chloro-5-[(3R)-3-methylmorpholin-4-yl]-2H-[1,3]thiazolo[4,5-b]pyridin-7-yl]oxane-4-carbonitrile (PubChem CID 169061211) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is 4-[3-chloro-5-[(3R)-3-methylmorpholin-4-yl]-2H-[1,3]thiazolo[4,5-b]pyridin-7-yl]oxane-4-carbonitrile.
| Compound Name | 4-[3-chloro-5-[(3R)-3-methylmorpholin-4-yl]-2H-[1,3]thiazolo[4,5-b]pyridin-7-yl]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 169061211 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[3-chloro-5-[(3R)-3-methylmorpholin-4-yl]-2H-[1,3]thiazolo[4,5-b]pyridin-7-yl]oxane-4-carbonitrile |
| SMILES | C[C@@H]1COCCN1c1cc(C2(C#N)CCOCC2)c2c(n1)N(Cl)CS2 |
| InChI | InChI=1S/C17H21ClN4O2S/c1-12-9-24-7-4-21(12)14-8-13(15-16(20-14)22(18)11-25-15)17(10-19)2-5-23-6-3-17/h8,12H,2-7,9,11H2,1H3/t12-/m1/s1 |
| InChIKey | HUZXFLDQLCYQOJ-GFCCVEGCSA-N |
| XLogP | 2.90 |
| TPSA | 61.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|