C9H11FN6O4 — CID 169068372
4-amino-1-[(2R,4S,5R)-5-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one (PubChem CID 169068372) has the molecular formula C9H11FN6O4 and a molecular weight of 286.22 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-5-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-5-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 169068372 |
| Molecular Formula | C9H11FN6O4 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-5-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](n2cc(F)c(N)nc2=O)C[C@@H]1O |
| InChI | InChI=1S/C9H11FN6O4/c10-4-2-16(8(19)13-7(4)11)6-1-5(18)9(3-17,20-6)14-15-12/h2,5-6,17-18H,1,3H2,(H2,11,13,19)/t5-,6+,9+/m0/s1 |
| InChIKey | LWGZFRAWDYEXNG-CCGCGBOQSA-N |
| XLogP | -0.76 |
| TPSA | 159.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|