C14H24N2O3S — CID 169069153
tert-butyl (2Z)-2-[4-(dimethylcarbamoylsulfanyl)piperidin-3-ylidene]acetate (PubChem CID 169069153) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is tert-butyl (2Z)-2-[4-(dimethylcarbamoylsulfanyl)piperidin-3-ylidene]acetate.
| Compound Name | tert-butyl (2Z)-2-[4-(dimethylcarbamoylsulfanyl)piperidin-3-ylidene]acetate |
|---|---|
| PubChem CID | 169069153 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | tert-butyl (2Z)-2-[4-(dimethylcarbamoylsulfanyl)piperidin-3-ylidene]acetate |
| SMILES | CN(C)C(=O)SC1CCNC/C1=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O3S/c1-14(2,3)19-12(17)8-10-9-15-7-6-11(10)20-13(18)16(4)5/h8,11,15H,6-7,9H2,1-5H3/b10-8- |
| InChIKey | CVFFJRORNJGCBQ-NTMALXAHSA-N |
| XLogP | 2.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|