About tert-butyl 2-cyclobutylideneacetate;formic acid
tert-butyl 2-cyclobutylideneacetate;formic acid (PubChem CID 162050243) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is tert-butyl 2-cyclobutylideneacetate;formic acid.
Molecular Properties
| Compound Name | tert-butyl 2-cyclobutylideneacetate;formic acid |
| PubChem CID | 162050243 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | tert-butyl 2-cyclobutylideneacetate;formic acid |
| SMILES | CC(C)(C)OC(=O)C=C1CCC1.O=CO |
| InChI | InChI=1S/C10H16O2.CH2O2/c1-10(2,3)12-9(11)7-8-5-4-6-8;2-1-3/h7H,4-6H2,1-3H3;1H,(H,2,3) |
| InChIKey | YYLJYBLMDUFWRE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-cyclobutylideneacetate;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-cyclobutylideneacetate;formic acid?
The IUPAC name of tert-butyl 2-cyclobutylideneacetate;formic acid (CID 162050243) is tert-butyl 2-cyclobutylideneacetate;formic acid.
What is the SMILES notation for tert-butyl 2-cyclobutylideneacetate;formic acid?
The canonical SMILES for tert-butyl 2-cyclobutylideneacetate;formic acid is CC(C)(C)OC(=O)C=C1CCC1.O=CO.
What is the InChIKey of tert-butyl 2-cyclobutylideneacetate;formic acid?
The InChIKey is YYLJYBLMDUFWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2.CH2O2/c1-10(2,3)12-9(11)7-8-5-4-6-8;2-1-3/h7H,4-6H2,1-3H3;1H,(H,2,3).
What are the key properties of tert-butyl 2-cyclobutylideneacetate;formic acid?
tert-butyl 2-cyclobutylideneacetate;formic acid has a molecular weight of 214.26 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-cyclobutylideneacetate;formic acid is sourced from PubChem (CID 162050243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).