C16H24N2O3 — CID 123906177
tert-butyl 2-[1-(2-methyl-6H-1,3-oxazin-4-yl)piperidin-4-ylidene]acetate (PubChem CID 123906177) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl 2-[1-(2-methyl-6H-1,3-oxazin-4-yl)piperidin-4-ylidene]acetate.
| Compound Name | tert-butyl 2-[1-(2-methyl-6H-1,3-oxazin-4-yl)piperidin-4-ylidene]acetate |
|---|---|
| PubChem CID | 123906177 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | tert-butyl 2-[1-(2-methyl-6H-1,3-oxazin-4-yl)piperidin-4-ylidene]acetate |
| SMILES | CC1=NC(N2CCC(=CC(=O)OC(C)(C)C)CC2)=CCO1 |
| InChI | InChI=1S/C16H24N2O3/c1-12-17-14(7-10-20-12)18-8-5-13(6-9-18)11-15(19)21-16(2,3)4/h7,11H,5-6,8-10H2,1-4H3 |
| InChIKey | PVIXOQOKGUCUBF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|