C12H17NO6 — CID 174157501
(2S,4E)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 174157501) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is (2S,4E)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4E)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 174157501 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (2S,4E)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC(C)(C)OC(=O)/C=C1\C[C@@H](C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C12H17NO6/c1-12(2,3)19-9(14)5-7-4-8(10(15)16)13(6-7)11(17)18/h5,8H,4,6H2,1-3H3,(H,15,16)(H,17,18)/b7-5+/t8-/m0/s1 |
| InChIKey | MEYLWNZAEVKNHX-IVGLGHLBSA-N |
| XLogP | 1.09 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|