C17H26N2O5 — CID 59681849
tert-butyl (2S)-4-(2-methoxy-2-oxoethylidene)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 59681849) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is tert-butyl (2S)-4-(2-methoxy-2-oxoethylidene)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(2-methoxy-2-oxoethylidene)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59681849 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl (2S)-4-(2-methoxy-2-oxoethylidene)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)C=C1C[C@@H](C(=O)N2CCCC2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H26N2O5/c1-17(2,3)24-16(22)19-11-12(10-14(20)23-4)9-13(19)15(21)18-7-5-6-8-18/h10,13H,5-9,11H2,1-4H3/t13-/m0/s1 |
| InChIKey | WTNAGOSOSSNMHS-ZDUSSCGKSA-N |
| XLogP | 1.72 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|