C38H26N2 — CID 169070907
2-methyl-1-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]phenyl]benzimidazole (PubChem CID 169070907) has the molecular formula C38H26N2 and a molecular weight of 525.73 g/mol. Its IUPAC name is 2-methyl-1-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]phenyl]benzimidazole.
| Compound Name | 2-methyl-1-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 169070907 |
| Molecular Formula | C38H26N2 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 2-methyl-1-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4ccccc4-n4c(C)nc5ccccc54)c4c([2H])c([2H])c([2H])c([2H])c34)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C38H26N2/c1-25-39-34-22-9-11-24-36(34)40(25)35-23-10-8-20-33(35)38-31-18-6-4-16-29(31)37(30-17-5-7-19-32(30)38)28-21-12-14-26-13-2-3-15-27(26)28/h2-24H,1H3/i2D,3D,4D,5D,6D,7D,12D,13D,14D,15D,16D,17D,18D,19D,21D |
| InChIKey | LUZPKVLHDQMUJQ-PFBDOQODSA-N |
| XLogP | 10.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|