C51H36N2 — CID 169071183
1-[6-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphthalen-2-yl]-2-ethylbenzimidazole (PubChem CID 169071183) has the molecular formula C51H36N2 and a molecular weight of 686.92 g/mol. Its IUPAC name is 1-[6-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphthalen-2-yl]-2-ethylbenzimidazole.
| Compound Name | 1-[6-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphthalen-2-yl]-2-ethylbenzimidazole |
|---|---|
| PubChem CID | 169071183 |
| Molecular Formula | C51H36N2 |
| Molecular Weight | 686.92 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | 1-[6-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphthalen-2-yl]-2-ethylbenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])cc(-c3c4ccccc4c(-c4ccc5cc(-n6c(CC)nc7ccccc76)ccc5c4)c4ccccc34)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H36N2/c1-2-49-52-47-23-13-14-24-48(47)53(49)42-28-27-36-29-38(26-25-37(36)33-42)50-43-19-9-11-21-45(43)51(46-22-12-10-20-44(46)50)41-31-39(34-15-5-3-6-16-34)30-40(32-41)35-17-7-4-8-18-35/h3-33H,2H2,1H3/i3D,4D,5D,6D,7D,8D,15D,16D,17D,18D |
| InChIKey | KQBXKHSFKMCIOR-DURQZGORSA-N |
| XLogP | 13.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.92 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|