C22H28FN3O2S — CID 16907157
3-fluoro-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide (PubChem CID 16907157) has the molecular formula C22H28FN3O2S and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-fluoro-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16907157 |
| Molecular Formula | C22H28FN3O2S |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-fluoro-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
| SMILES | CN1CCCc2cc(C(CNS(=O)(=O)c3cccc(F)c3)N3CCCC3)ccc21 |
| InChI | InChI=1S/C22H28FN3O2S/c1-25-11-5-6-17-14-18(9-10-21(17)25)22(26-12-2-3-13-26)16-24-29(27,28)20-8-4-7-19(23)15-20/h4,7-10,14-15,22,24H,2-3,5-6,11-13,16H2,1H3 |
| InChIKey | IPNNOKQEPQWKCU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|