C22H28FN3O2S — CID 16907640
4-fluoro-3-methyl-N-[2-(1-methyl-2,3-dihydroindol-5-yl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide (PubChem CID 16907640) has the molecular formula C22H28FN3O2S and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[2-(1-methyl-2,3-dihydroindol-5-yl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-[2-(1-methyl-2,3-dihydroindol-5-yl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16907640 |
| Molecular Formula | C22H28FN3O2S |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 4-fluoro-3-methyl-N-[2-(1-methyl-2,3-dihydroindol-5-yl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(c2ccc3c(c2)CCN3C)N2CCCC2)ccc1F |
| InChI | InChI=1S/C22H28FN3O2S/c1-16-13-19(6-7-20(16)23)29(27,28)24-15-22(26-10-3-4-11-26)17-5-8-21-18(14-17)9-12-25(21)2/h5-8,13-14,22,24H,3-4,9-12,15H2,1-2H3 |
| InChIKey | SAYKXEVEPWZLIY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|