C22H25FN6O2 — CID 169075262
tert-butyl N-[2-fluoro-4-methyl-3-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]carbamate (PubChem CID 169075262) has the molecular formula C22H25FN6O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-4-methyl-3-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-4-methyl-3-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 169075262 |
| Molecular Formula | C22H25FN6O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | tert-butyl N-[2-fluoro-4-methyl-3-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]carbamate |
| SMILES | C/N=c1\ncc2cc(-c3c(C)ccc(NC(=O)OC(C)(C)C)c3F)c3n(c-2n1)CCN3 |
| InChI | InChI=1S/C22H25FN6O2/c1-12-6-7-15(27-21(30)31-22(2,3)4)17(23)16(12)14-10-13-11-26-20(24-5)28-18(13)29-9-8-25-19(14)29/h6-7,10-11,25H,8-9H2,1-5H3,(H,27,30)/b24-20+ |
| InChIKey | ILFNHHKQFWWRDI-HIXSDJFHSA-N |
| XLogP | 3.80 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |