C11H21N — CID 169076055
(1R,5S)-3-tert-butyl-3-azabicyclo[3.2.1]octane (PubChem CID 169076055) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (1R,5S)-3-tert-butyl-3-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-3-tert-butyl-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 169076055 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (1R,5S)-3-tert-butyl-3-azabicyclo[3.2.1]octane |
| SMILES | CC(C)(C)N1C[C@@H]2CC[C@@H](C2)C1 |
| InChI | InChI=1S/C11H21N/c1-11(2,3)12-7-9-4-5-10(6-9)8-12/h9-10H,4-8H2,1-3H3/t9-,10+ |
| InChIKey | NQWKEXNSGAEFLE-AOOOYVTPSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |