C35H30NSi+ — CID 169077173
1-methyl-2-(3,5,5-trimethyl-6-phenanthren-9-ylbenzo[b][1]benzosilol-4-yl)pyridin-1-ium (PubChem CID 169077173) has the molecular formula C35H30NSi+ and a molecular weight of 492.72 g/mol. Its IUPAC name is 1-methyl-2-(3,5,5-trimethyl-6-phenanthren-9-ylbenzo[b][1]benzosilol-4-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(3,5,5-trimethyl-6-phenanthren-9-ylbenzo[b][1]benzosilol-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 169077173 |
| Molecular Formula | C35H30NSi+ |
| Molecular Weight | 492.72 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 1-methyl-2-(3,5,5-trimethyl-6-phenanthren-9-ylbenzo[b][1]benzosilol-4-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c(c1-c1cccc[n+]1C)[Si](C)(C)c1c-2cccc1-c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C35H30NSi/c1-23-19-20-30-28-16-11-17-29(31-22-24-12-5-6-13-25(24)26-14-7-8-15-27(26)31)34(28)37(3,4)35(30)33(23)32-18-9-10-21-36(32)2/h5-22H,1-4H3/q+1 |
| InChIKey | SKLPOJGDWZGCSC-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.72 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|