C8H13N — CID 169077732
3-(1-methylcyclopropyl)-2,5-dihydro-1H-pyrrole (PubChem CID 169077732) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 3-(1-methylcyclopropyl)-2,5-dihydro-1H-pyrrole.
| Compound Name | 3-(1-methylcyclopropyl)-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 169077732 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 3-(1-methylcyclopropyl)-2,5-dihydro-1H-pyrrole |
| SMILES | CC1(C2=CCNC2)CC1 |
| InChI | InChI=1S/C8H13N/c1-8(3-4-8)7-2-5-9-6-7/h2,9H,3-6H2,1H3 |
| InChIKey | ADAZAQQZPYRLQH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|