C9H16N2 — CID 123795242
5-(1-methylcyclopropyl)-1,2,3,6-tetrahydropyridin-2-amine (PubChem CID 123795242) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 5-(1-methylcyclopropyl)-1,2,3,6-tetrahydropyridin-2-amine.
| Compound Name | 5-(1-methylcyclopropyl)-1,2,3,6-tetrahydropyridin-2-amine |
|---|---|
| PubChem CID | 123795242 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 5-(1-methylcyclopropyl)-1,2,3,6-tetrahydropyridin-2-amine |
| SMILES | CC1(C2=CCC(N)NC2)CC1 |
| InChI | InChI=1S/C9H16N2/c1-9(4-5-9)7-2-3-8(10)11-6-7/h2,8,11H,3-6,10H2,1H3 |
| InChIKey | UNYFXSILMQYIJN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|