C11H22N2 — CID 123905526
5-butan-2-yl-N,3-dimethyl-1,2,3,6-tetrahydropyridin-6-amine (PubChem CID 123905526) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 5-butan-2-yl-N,3-dimethyl-1,2,3,6-tetrahydropyridin-6-amine.
| Compound Name | 5-butan-2-yl-N,3-dimethyl-1,2,3,6-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 123905526 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 5-butan-2-yl-N,3-dimethyl-1,2,3,6-tetrahydropyridin-6-amine |
| SMILES | CCC(C)C1=CC(C)CNC1NC |
| InChI | InChI=1S/C11H22N2/c1-5-9(3)10-6-8(2)7-13-11(10)12-4/h6,8-9,11-13H,5,7H2,1-4H3 |
| InChIKey | VKRGWHXPYVCYJC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|