C10H17N — CID 123480536
4-pent-1-en-3-yl-1,2,3,6-tetrahydropyridine (PubChem CID 123480536) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 4-pent-1-en-3-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-pent-1-en-3-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 123480536 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 4-pent-1-en-3-yl-1,2,3,6-tetrahydropyridine |
| SMILES | C=CC(CC)C1=CCNCC1 |
| InChI | InChI=1S/C10H17N/c1-3-9(4-2)10-5-7-11-8-6-10/h3,5,9,11H,1,4,6-8H2,2H3 |
| InChIKey | WMPGQIGYOFISMT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|