C43H38N2O2 — CID 169078210
18,24-ditert-butyl-21,21-dimethyl-5-phenyl-1,5-diazaoctacyclo[14.11.1.13,26.02,14.04,12.06,11.020,28.022,27]nonacosa-2(14),3,6,8,10,12,16(28),17,19,22,24,26-dodecaene-15,29-dione (PubChem CID 169078210) has the molecular formula C43H38N2O2 and a molecular weight of 614.79 g/mol. Its IUPAC name is 18,24-ditert-butyl-21,21-dimethyl-5-phenyl-1,5-diazaoctacyclo[14.11.1.13,26.02,14.04,12.06,11.020,28.022,27]nonacosa-2(14),3,6,8,10,12,16(28),17,19,22,24,26-dodecaene-15,29-dione.
| Compound Name | 18,24-ditert-butyl-21,21-dimethyl-5-phenyl-1,5-diazaoctacyclo[14.11.1.13,26.02,14.04,12.06,11.020,28.022,27]nonacosa-2(14),3,6,8,10,12,16(28),17,19,22,24,26-dodecaene-15,29-dione |
|---|---|
| PubChem CID | 169078210 |
| Molecular Formula | C43H38N2O2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | 18,24-ditert-butyl-21,21-dimethyl-5-phenyl-1,5-diazaoctacyclo[14.11.1.13,26.02,14.04,12.06,11.020,28.022,27]nonacosa-2(14),3,6,8,10,12,16(28),17,19,22,24,26-dodecaene-15,29-dione |
| SMILES | CC(C)(C)c1cc2c3c(c1)c(=O)c1cc4c5ccccc5n(-c5ccccc5)c4c4c(=O)c5cc(C(C)(C)C)cc(c5n3c14)C2(C)C |
| InChI | InChI=1S/C43H38N2O2/c1-41(2,3)23-18-28-35-31(20-23)43(7,8)32-21-24(42(4,5)6)19-29-36(32)45(35)38-30(39(28)46)22-27-26-16-12-13-17-33(26)44(25-14-10-9-11-15-25)37(27)34(38)40(29)47/h9-22H,1-8H3 |
| InChIKey | HSANYPQKWOPVHR-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 43.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|