C34H27NO3 — CID 169078168
5,13-ditert-butyl-19-oxa-9-azaoctacyclo[15.10.1.03,8.07,11.09,28.010,15.018,26.020,25]octacosa-1(28),3,5,7,10,12,14,17,20,22,24,26-dodecaene-2,16-dione (PubChem CID 169078168) has the molecular formula C34H27NO3 and a molecular weight of 497.59 g/mol. Its IUPAC name is 5,13-ditert-butyl-19-oxa-9-azaoctacyclo[15.10.1.03,8.07,11.09,28.010,15.018,26.020,25]octacosa-1(28),3,5,7,10,12,14,17,20,22,24,26-dodecaene-2,16-dione.
| Compound Name | 5,13-ditert-butyl-19-oxa-9-azaoctacyclo[15.10.1.03,8.07,11.09,28.010,15.018,26.020,25]octacosa-1(28),3,5,7,10,12,14,17,20,22,24,26-dodecaene-2,16-dione |
|---|---|
| PubChem CID | 169078168 |
| Molecular Formula | C34H27NO3 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 5,13-ditert-butyl-19-oxa-9-azaoctacyclo[15.10.1.03,8.07,11.09,28.010,15.018,26.020,25]octacosa-1(28),3,5,7,10,12,14,17,20,22,24,26-dodecaene-2,16-dione |
| SMILES | CC(C)(C)c1cc2c(=O)c3cc4c5ccccc5oc4c4c(=O)c5cc(C(C)(C)C)cc6c(c1)c2n(c56)c34 |
| InChI | InChI=1S/C34H27NO3/c1-33(2,3)16-11-19-20-12-17(34(4,5)6)14-23-28(20)35-27(19)22(13-16)30(36)24-15-21-18-9-7-8-10-25(18)38-32(21)26(29(24)35)31(23)37/h7-15H,1-6H3 |
| InChIKey | XCEZDCPXOYQVMM-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 51.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|