C36H21NO4 — CID 169078196
5-tert-butyl-18,24-dioxa-1-azadecacyclo[18.14.1.02,7.03,33.09,35.011,19.012,17.022,34.023,31.025,30]pentatriaconta-2,4,6,9(35),10,12,14,16,19,22,25,27,29,31,33-pentadecaene-8,21-dione (PubChem CID 169078196) has the molecular formula C36H21NO4 and a molecular weight of 531.57 g/mol. Its IUPAC name is 5-tert-butyl-18,24-dioxa-1-azadecacyclo[18.14.1.02,7.03,33.09,35.011,19.012,17.022,34.023,31.025,30]pentatriaconta-2,4,6,9(35),10,12,14,16,19,22,25,27,29,31,33-pentadecaene-8,21-dione.
| Compound Name | 5-tert-butyl-18,24-dioxa-1-azadecacyclo[18.14.1.02,7.03,33.09,35.011,19.012,17.022,34.023,31.025,30]pentatriaconta-2,4,6,9(35),10,12,14,16,19,22,25,27,29,31,33-pentadecaene-8,21-dione |
|---|---|
| PubChem CID | 169078196 |
| Molecular Formula | C36H21NO4 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 5-tert-butyl-18,24-dioxa-1-azadecacyclo[18.14.1.02,7.03,33.09,35.011,19.012,17.022,34.023,31.025,30]pentatriaconta-2,4,6,9(35),10,12,14,16,19,22,25,27,29,31,33-pentadecaene-8,21-dione |
| SMILES | CC(C)(C)c1cc2c(=O)c3cc4c5ccccc5oc4c4c(=O)c5c6oc7ccccc7c6cc6c(c1)c2n(c34)c65 |
| InChI | InChI=1S/C36H21NO4/c1-36(2,3)16-12-19-20-14-21-17-8-4-6-10-25(17)40-34(21)27-30(20)37-29(19)23(13-16)32(38)24-15-22-18-9-5-7-11-26(18)41-35(22)28(31(24)37)33(27)39/h4-15H,1-3H3 |
| InChIKey | BQMLPLHZXXWCSG-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 64.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|