C38H30BN4O2Pt- — CID 169078631
2-[9-(4-tert-butyl-2-pyridinyl)pyrido[2,3-b]indol-2-yl]oxy-10-hydroxy-5-phenyl-1H-benzo[b][1,4]benzazaborinin-1-ide;platinum (PubChem CID 169078631) has the molecular formula C38H30BN4O2Pt- and a molecular weight of 780.57 g/mol. Its IUPAC name is 2-[9-(4-tert-butyl-2-pyridinyl)pyrido[2,3-b]indol-2-yl]oxy-10-hydroxy-5-phenyl-1H-benzo[b][1,4]benzazaborinin-1-ide;platinum.
| Compound Name | 2-[9-(4-tert-butyl-2-pyridinyl)pyrido[2,3-b]indol-2-yl]oxy-10-hydroxy-5-phenyl-1H-benzo[b][1,4]benzazaborinin-1-ide;platinum |
|---|---|
| PubChem CID | 169078631 |
| Molecular Formula | C38H30BN4O2Pt- |
| Molecular Weight | 780.57 g/mol |
| Exact Mass | 780.21 |
| IUPAC Name | 2-[9-(4-tert-butyl-2-pyridinyl)pyrido[2,3-b]indol-2-yl]oxy-10-hydroxy-5-phenyl-1H-benzo[b][1,4]benzazaborinin-1-ide;platinum |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4[c-]c5c(cc4)N(c4ccccc4)c4ccccc4B5O)nc32)c1.[Pt] |
| InChI | InChI=1S/C38H30BN4O2.Pt/c1-38(2,3)25-21-22-40-35(23-25)43-32-15-9-7-13-28(32)29-18-20-36(41-37(29)43)45-27-17-19-34-31(24-27)39(44)30-14-8-10-16-33(30)42(34)26-11-5-4-6-12-26;/h4-23,44H,1-3H3;/q-1; |
| InChIKey | ZNBKDUPSVHRISH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|