C50H40BN6OPt- — CID 169078719
1-[6-[9-(4-tert-butyl-2-pyridinyl)pyrido[2,3-b]indol-2-yl]oxy-2-pyridinyl]-3-(2,6-diphenylphenyl)-2-methanidyl-1,3,2-benzodiazaborole;platinum (PubChem CID 169078719) has the molecular formula C50H40BN6OPt- and a molecular weight of 946.80 g/mol. Its IUPAC name is 1-[6-[9-(4-tert-butyl-2-pyridinyl)pyrido[2,3-b]indol-2-yl]oxy-2-pyridinyl]-3-(2,6-diphenylphenyl)-2-methanidyl-1,3,2-benzodiazaborole;platinum.
| Compound Name | 1-[6-[9-(4-tert-butyl-2-pyridinyl)pyrido[2,3-b]indol-2-yl]oxy-2-pyridinyl]-3-(2,6-diphenylphenyl)-2-methanidyl-1,3,2-benzodiazaborole;platinum |
|---|---|
| PubChem CID | 169078719 |
| Molecular Formula | C50H40BN6OPt- |
| Molecular Weight | 946.80 g/mol |
| Exact Mass | 946.30 |
| IUPAC Name | 1-[6-[9-(4-tert-butyl-2-pyridinyl)pyrido[2,3-b]indol-2-yl]oxy-2-pyridinyl]-3-(2,6-diphenylphenyl)-2-methanidyl-1,3,2-benzodiazaborole;platinum |
| SMILES | [CH2-]B1N(c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4n3)n2)c2ccccc2N1c1c(-c2ccccc2)cccc1-c1ccccc1.[Pt] |
| InChI | InChI=1S/C50H40BN6O.Pt/c1-50(2,3)36-31-32-52-45(33-36)55-41-24-12-11-21-39(41)40-29-30-47(54-49(40)55)58-46-28-16-27-44(53-46)56-42-25-13-14-26-43(42)57(51(56)4)48-37(34-17-7-5-8-18-34)22-15-23-38(48)35-19-9-6-10-20-35;/h5-33H,4H2,1-3H3;/q-1; |
| InChIKey | IWTWOZVDVZLTNJ-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.80 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|